About 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline
4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline (PubChem CID 142858955) has the molecular formula C25H25F3N2O2
and a molecular weight of 442.48 g/mol. Its IUPAC name is 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline.
Molecular Properties
| Compound Name | 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline |
| PubChem CID | 142858955 |
| Molecular Formula | C25H25F3N2O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline |
| SMILES | COCCOc1c(F)ccc2nccc(F)c12.Cc1ccc2nccc(C(C)C)c2c1F |
| InChI | InChI=1S/C13H14FN.C12H11F2NO2/c1-8(2)10-6-7-15-11-5-4-9(3)13(14)12(10)11;1-16-6-7-17-12-9(14)2-3-10-11(12)8(13)4-5-15-10/h4-8H,1-3H3;2-5H,6-7H2,1H3 |
| InChIKey | GDBINIJAWPJLOA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline?
The IUPAC name of 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline (CID 142858955) is 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline.
What is the SMILES notation for 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline?
The canonical SMILES for 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline is COCCOc1c(F)ccc2nccc(F)c12.Cc1ccc2nccc(C(C)C)c2c1F.
What is the InChIKey of 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline?
The InChIKey is GDBINIJAWPJLOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN.C12H11F2NO2/c1-8(2)10-6-7-15-11-5-4-9(3)13(14)12(10)11;1-16-6-7-17-12-9(14)2-3-10-11(12)8(13)4-5-15-10/h4-8H,1-3H3;2-5H,6-7H2,1H3.
What are the key properties of 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline?
4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline has a molecular weight of 442.48 g/mol, XLogP of 6.34, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-difluoro-5-(2-methoxyethoxy)quinoline;5-fluoro-6-methyl-4-propan-2-ylquinoline is sourced from PubChem (CID 142858955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).