About 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate
4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate (PubChem CID 142859148) has the molecular formula C17H20BrNO3S
and a molecular weight of 398.32 g/mol. Its IUPAC name is 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate.
Molecular Properties
| Compound Name | 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate |
| PubChem CID | 142859148 |
| Molecular Formula | C17H20BrNO3S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC=C(CNC)C=C1.O=Cc1cc(Br)cs1 |
| InChI | InChI=1S/C12H17NO2.C5H3BrOS/c1-3-15-12(14)11-6-4-5-10(7-8-11)9-13-2;6-4-1-5(2-7)8-3-4/h5-8,13H,3-4,9H2,1-2H3;1-3H |
| InChIKey | WRBVMKKGDYSLHJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
The IUPAC name of 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate (CID 142859148) is 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate.
What is the SMILES notation for 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
The canonical SMILES for 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate is CCOC(=O)C1=CCC=C(CNC)C=C1.O=Cc1cc(Br)cs1.
What is the InChIKey of 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
The InChIKey is WRBVMKKGDYSLHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.C5H3BrOS/c1-3-15-12(14)11-6-4-5-10(7-8-11)9-13-2;6-4-1-5(2-7)8-3-4/h5-8,13H,3-4,9H2,1-2H3;1-3H.
What are the key properties of 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate?
4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate has a molecular weight of 398.32 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromothiophene-2-carbaldehyde;ethyl 5-(methylaminomethyl)cyclohepta-1,4,6-triene-1-carboxylate is sourced from PubChem (CID 142859148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).