C29H24I2N6O2S — CID 142860041
1,3-bis(2-iodophenyl)-1-[[4-methyl-3-[(4-pyridin-3-yl-2,3-dihydro-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]urea (PubChem CID 142860041) has the molecular formula C29H24I2N6O2S and a molecular weight of 774.43 g/mol. Its IUPAC name is 1,3-bis(2-iodophenyl)-1-[[4-methyl-3-[(4-pyridin-3-yl-2,3-dihydro-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]urea.
| Compound Name | 1,3-bis(2-iodophenyl)-1-[[4-methyl-3-[(4-pyridin-3-yl-2,3-dihydro-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]urea |
|---|---|
| PubChem CID | 142860041 |
| Molecular Formula | C29H24I2N6O2S |
| Molecular Weight | 774.43 g/mol |
| Exact Mass | 773.98 |
| IUPAC Name | 1,3-bis(2-iodophenyl)-1-[[4-methyl-3-[(4-pyridin-3-yl-2,3-dihydro-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]urea |
| SMILES | Cc1ccc(NC(=O)N(C(=O)Nc2ccccc2I)c2ccccc2I)cc1NC1NC(c2cccnc2)=CS1 |
| InChI | InChI=1S/C29H24I2N6O2S/c1-18-12-13-20(15-24(18)34-27-35-25(17-40-27)19-7-6-14-32-16-19)33-28(38)37(26-11-5-3-9-22(26)31)29(39)36-23-10-4-2-8-21(23)30/h2-17,27,34-35H,1H3,(H,33,38)(H,36,39) |
| InChIKey | AQDXMQSJKIWQAB-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.43 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|