C23H32N6 — CID 142860140
(3Z)-3-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-6-(1-methylpiperidin-4-yl)-5-pent-1-en-2-yl-4H-pyridin-2-amine (PubChem CID 142860140) has the molecular formula C23H32N6 and a molecular weight of 392.55 g/mol. Its IUPAC name is (3Z)-3-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-6-(1-methylpiperidin-4-yl)-5-pent-1-en-2-yl-4H-pyridin-2-amine.
| Compound Name | (3Z)-3-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-6-(1-methylpiperidin-4-yl)-5-pent-1-en-2-yl-4H-pyridin-2-amine |
|---|---|
| PubChem CID | 142860140 |
| Molecular Formula | C23H32N6 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (3Z)-3-(aminomethylidene)-4-(5,6-diiminocyclohexa-1,3-dien-1-yl)-6-(1-methylpiperidin-4-yl)-5-pent-1-en-2-yl-4H-pyridin-2-amine |
| SMILES | [H]/N=C1/C(C2C(C(=C)CCC)=C(C3CCN(C)CC3)N=C(N)/C2=C\N)=CC=C/C1=N\[H] |
| InChI | InChI=1S/C23H32N6/c1-4-6-14(2)19-20(16-7-5-8-18(25)21(16)26)17(13-24)23(27)28-22(19)15-9-11-29(3)12-10-15/h5,7-8,13,15,20,25-26H,2,4,6,9-12,24H2,1,3H3,(H2,27,28)/b17-13-,25-18+,26-21- |
| InChIKey | KYEHIEHABSIYAR-XUBAGFEZSA-N |
| XLogP | 3.30 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|