C15H24O — CID 14286031
4,4,8-trimethyltricyclo[6.3.1.02,5]dodec-1(11)-en-10-ol (PubChem CID 14286031) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 4,4,8-trimethyltricyclo[6.3.1.02,5]dodec-1(11)-en-10-ol.
| Compound Name | 4,4,8-trimethyltricyclo[6.3.1.02,5]dodec-1(11)-en-10-ol |
|---|---|
| PubChem CID | 14286031 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 4,4,8-trimethyltricyclo[6.3.1.02,5]dodec-1(11)-en-10-ol |
| SMILES | CC12CCC3C(CC3(C)C)C(=CC(O)C1)C2 |
| InChI | InChI=1S/C15H24O/c1-14(2)9-12-10-6-11(16)8-15(3,7-10)5-4-13(12)14/h6,11-13,16H,4-5,7-9H2,1-3H3 |
| InChIKey | ZFCWIYMRAXIXKT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|