C25H23N7O3 — CID 142860871
N-[1-(3-amino-3-hydroxypropyl)-5-[benzoyl(methyl)amino]benzimidazol-2-yl]-6-cyanopyridine-3-carboxamide (PubChem CID 142860871) has the molecular formula C25H23N7O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is N-[1-(3-amino-3-hydroxypropyl)-5-[benzoyl(methyl)amino]benzimidazol-2-yl]-6-cyanopyridine-3-carboxamide.
| Compound Name | N-[1-(3-amino-3-hydroxypropyl)-5-[benzoyl(methyl)amino]benzimidazol-2-yl]-6-cyanopyridine-3-carboxamide |
|---|---|
| PubChem CID | 142860871 |
| Molecular Formula | C25H23N7O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-[1-(3-amino-3-hydroxypropyl)-5-[benzoyl(methyl)amino]benzimidazol-2-yl]-6-cyanopyridine-3-carboxamide |
| SMILES | CN(C(=O)c1ccccc1)c1ccc2c(c1)nc(NC(=O)c1ccc(C#N)nc1)n2CCC(N)O |
| InChI | InChI=1S/C25H23N7O3/c1-31(24(35)16-5-3-2-4-6-16)19-9-10-21-20(13-19)29-25(32(21)12-11-22(27)33)30-23(34)17-7-8-18(14-26)28-15-17/h2-10,13,15,22,33H,11-12,27H2,1H3,(H,29,30,34) |
| InChIKey | APERVSNZROCYFX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|