C12H19NO — CID 142860963
3,3-dimethyl-2,4-dihydro-1,4-benzoxazine;ethane (PubChem CID 142860963) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1,4-benzoxazine;ethane.
| Compound Name | 3,3-dimethyl-2,4-dihydro-1,4-benzoxazine;ethane |
|---|---|
| PubChem CID | 142860963 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydro-1,4-benzoxazine;ethane |
| SMILES | CC.CC1(C)COc2ccccc2N1 |
| InChI | InChI=1S/C10H13NO.C2H6/c1-10(2)7-12-9-6-4-3-5-8(9)11-10;1-2/h3-6,11H,7H2,1-2H3;1-2H3 |
| InChIKey | PEPXIJJHSJJIEA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |