C14H22F3NO — CID 142861213
ethane;N-[(2S,3E,4Z)-3-ethylidene-6-methylhepta-4,6-dien-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 142861213) has the molecular formula C14H22F3NO and a molecular weight of 277.33 g/mol. Its IUPAC name is ethane;N-[(2S,3E,4Z)-3-ethylidene-6-methylhepta-4,6-dien-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | ethane;N-[(2S,3E,4Z)-3-ethylidene-6-methylhepta-4,6-dien-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142861213 |
| Molecular Formula | C14H22F3NO |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethane;N-[(2S,3E,4Z)-3-ethylidene-6-methylhepta-4,6-dien-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C=C(C)/C=C\C(=C/C)[C@H](C)NC(=O)C(F)(F)F.CC |
| InChI | InChI=1S/C12H16F3NO.C2H6/c1-5-10(7-6-8(2)3)9(4)16-11(17)12(13,14)15;1-2/h5-7,9H,2H2,1,3-4H3,(H,16,17);1-2H3/b7-6-,10-5-;/t9-;/m0./s1 |
| InChIKey | KIRIOHLQCSNYJH-LTCXCPJJSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|