About N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine
N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine (PubChem CID 142861701) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine |
| PubChem CID | 142861701 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine |
| SMILES | C=CCC=C/C=C(\C)COCNC |
| InChI | InChI=1S/C11H19NO/c1-4-5-6-7-8-11(2)9-13-10-12-3/h4,6-8,12H,1,5,9-10H2,2-3H3/b7-6?,11-8+ |
| InChIKey | YCRAIOPOIYIJMI-HIRHDMDCSA-N |
| XLogP | 2.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine?
The IUPAC name of N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine (CID 142861701) is N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine.
What is the SMILES notation for N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine?
The canonical SMILES for N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine is C=CCC=C/C=C(\C)COCNC.
What is the InChIKey of N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine?
The InChIKey is YCRAIOPOIYIJMI-HIRHDMDCSA-N. The full InChI is InChI=1S/C11H19NO/c1-4-5-6-7-8-11(2)9-13-10-12-3/h4,6-8,12H,1,5,9-10H2,2-3H3/b7-6?,11-8+.
What are the key properties of N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine?
N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine has a molecular weight of 181.28 g/mol, XLogP of 2.26, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(2E)-2-methylocta-2,4,7-trienoxy]methanamine is sourced from PubChem (CID 142861701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).