C24H28F3N3O2 — CID 142861763
3-(hex-5-enylamino)-1-(6-methoxy-3-pyridinyl)-3H-indol-2-one;4,4,4-trifluorobut-1-ene (PubChem CID 142861763) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 3-(hex-5-enylamino)-1-(6-methoxy-3-pyridinyl)-3H-indol-2-one;4,4,4-trifluorobut-1-ene.
| Compound Name | 3-(hex-5-enylamino)-1-(6-methoxy-3-pyridinyl)-3H-indol-2-one;4,4,4-trifluorobut-1-ene |
|---|---|
| PubChem CID | 142861763 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 3-(hex-5-enylamino)-1-(6-methoxy-3-pyridinyl)-3H-indol-2-one;4,4,4-trifluorobut-1-ene |
| SMILES | C=CCC(F)(F)F.C=CCCCCNC1C(=O)N(c2ccc(OC)nc2)c2ccccc21 |
| InChI | InChI=1S/C20H23N3O2.C4H5F3/c1-3-4-5-8-13-21-19-16-9-6-7-10-17(16)23(20(19)24)15-11-12-18(25-2)22-14-15;1-2-3-4(5,6)7/h3,6-7,9-12,14,19,21H,1,4-5,8,13H2,2H3;2H,1,3H2 |
| InChIKey | XGHVFQNKXZFKII-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|