About acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine
acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 142861948) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine.
Molecular Properties
| Compound Name | acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine |
| PubChem CID | 142861948 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | C#C.C/C=c1/c(CCNCCOC)c[nH]/c1=C/C |
| InChI | InChI=1S/C13H22N2O.C2H2/c1-4-12-11(10-15-13(12)5-2)6-7-14-8-9-16-3;1-2/h4-5,10,14-15H,6-9H2,1-3H3;1-2H/b12-4-,13-5+; |
| InChIKey | SQLLLJLRMFVSDP-QEHHFKCISA-N |
| XLogP | 0.64 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine?
The IUPAC name of acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine (CID 142861948) is acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine.
What is the SMILES notation for acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine?
The canonical SMILES for acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine is C#C.C/C=c1/c(CCNCCOC)c[nH]/c1=C/C.
What is the InChIKey of acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine?
The InChIKey is SQLLLJLRMFVSDP-QEHHFKCISA-N. The full InChI is InChI=1S/C13H22N2O.C2H2/c1-4-12-11(10-15-13(12)5-2)6-7-14-8-9-16-3;1-2/h4-5,10,14-15H,6-9H2,1-3H3;1-2H/b12-4-,13-5+;.
What are the key properties of acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine?
acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine has a molecular weight of 248.37 g/mol, XLogP of 0.64, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-N-(2-methoxyethyl)ethanamine is sourced from PubChem (CID 142861948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).