About 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine
4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine (PubChem CID 142862526) has the molecular formula C13H16F3N
and a molecular weight of 243.27 g/mol. Its IUPAC name is 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine.
Molecular Properties
| Compound Name | 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine |
| PubChem CID | 142862526 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine |
| SMILES | FC(F)(F)C1=CC=CCC=C1C1CCNCC1 |
| InChI | InChI=1S/C13H16F3N/c14-13(15,16)12-5-3-1-2-4-11(12)10-6-8-17-9-7-10/h1,3-5,10,17H,2,6-9H2 |
| InChIKey | IRPAXUCSWBRSOJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine?
The IUPAC name of 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine (CID 142862526) is 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine.
What is the SMILES notation for 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine?
The canonical SMILES for 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine is FC(F)(F)C1=CC=CCC=C1C1CCNCC1.
What is the InChIKey of 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine?
The InChIKey is IRPAXUCSWBRSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N/c14-13(15,16)12-5-3-1-2-4-11(12)10-6-8-17-9-7-10/h1,3-5,10,17H,2,6-9H2.
What are the key properties of 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine?
4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine has a molecular weight of 243.27 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[7-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]piperidine is sourced from PubChem (CID 142862526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).