C34H40N6O4 — CID 142862713
N-[3-[[amino-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamoyl]amino]-5-tert-butyl-2-methoxyphenyl]acetamide (PubChem CID 142862713) has the molecular formula C34H40N6O4 and a molecular weight of 596.73 g/mol. Its IUPAC name is N-[3-[[amino-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamoyl]amino]-5-tert-butyl-2-methoxyphenyl]acetamide.
| Compound Name | N-[3-[[amino-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamoyl]amino]-5-tert-butyl-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 142862713 |
| Molecular Formula | C34H40N6O4 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | N-[3-[[amino-[4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]naphthalen-1-yl]carbamoyl]amino]-5-tert-butyl-2-methoxyphenyl]acetamide |
| SMILES | COc1c(NC(C)=O)cc(C(C)(C)C)cc1NC(=O)N(N)c1ccc(-c2ccc(CN3CCOCC3)nc2)c2ccccc12 |
| InChI | InChI=1S/C34H40N6O4/c1-22(41)37-29-18-24(34(2,3)4)19-30(32(29)43-5)38-33(42)40(35)31-13-12-26(27-8-6-7-9-28(27)31)23-10-11-25(36-20-23)21-39-14-16-44-17-15-39/h6-13,18-20H,14-17,21,35H2,1-5H3,(H,37,41)(H,38,42) |
| InChIKey | WSNIGWWDUTWGFE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|