C37H29N3O2 — CID 142862773
2-methyl-3-[4-(4-phenoxyphenyl)-5-[(4-phenoxyphenyl)methyl]-1H-imidazol-2-yl]-1H-indole (PubChem CID 142862773) has the molecular formula C37H29N3O2 and a molecular weight of 547.66 g/mol. Its IUPAC name is 2-methyl-3-[4-(4-phenoxyphenyl)-5-[(4-phenoxyphenyl)methyl]-1H-imidazol-2-yl]-1H-indole.
| Compound Name | 2-methyl-3-[4-(4-phenoxyphenyl)-5-[(4-phenoxyphenyl)methyl]-1H-imidazol-2-yl]-1H-indole |
|---|---|
| PubChem CID | 142862773 |
| Molecular Formula | C37H29N3O2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 2-methyl-3-[4-(4-phenoxyphenyl)-5-[(4-phenoxyphenyl)methyl]-1H-imidazol-2-yl]-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1-c1nc(-c2ccc(Oc3ccccc3)cc2)c(Cc2ccc(Oc3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C37H29N3O2/c1-25-35(32-14-8-9-15-33(32)38-25)37-39-34(24-26-16-20-30(21-17-26)41-28-10-4-2-5-11-28)36(40-37)27-18-22-31(23-19-27)42-29-12-6-3-7-13-29/h2-23,38H,24H2,1H3,(H,39,40) |
| InChIKey | WLEMLGYERRRKFQ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |