About 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine
6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 142862894) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 142862894 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | C1=CC(c2cc3nccnc3[nH]2)=CCC1 |
| InChI | InChI=1S/C12H11N3/c1-2-4-9(5-3-1)10-8-11-12(15-10)14-7-6-13-11/h2,4-8H,1,3H2,(H,14,15) |
| InChIKey | AMQYPXJQVJZVIG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine (CID 142862894) is 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine is C1=CC(c2cc3nccnc3[nH]2)=CCC1.
What is the InChIKey of 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is AMQYPXJQVJZVIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-2-4-9(5-3-1)10-8-11-12(15-10)14-7-6-13-11/h2,4-8H,1,3H2,(H,14,15).
What are the key properties of 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine?
6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 197.24 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexa-1,5-dien-1-yl-5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 142862894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).