C29H51NO2 — CID 142863270
[[4-[(1E)-buta-1,3-dienyl]-3,5-dimethylcyclohex-3-en-1-yl]amino]methanol;ethane;3,5,5-trimethyl-4-propa-1,2-dienylcyclohex-3-en-1-ol (PubChem CID 142863270) has the molecular formula C29H51NO2 and a molecular weight of 445.73 g/mol. Its IUPAC name is [[4-[(1E)-buta-1,3-dienyl]-3,5-dimethylcyclohex-3-en-1-yl]amino]methanol;ethane;3,5,5-trimethyl-4-propa-1,2-dienylcyclohex-3-en-1-ol.
| Compound Name | [[4-[(1E)-buta-1,3-dienyl]-3,5-dimethylcyclohex-3-en-1-yl]amino]methanol;ethane;3,5,5-trimethyl-4-propa-1,2-dienylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 142863270 |
| Molecular Formula | C29H51NO2 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 445.39 |
| IUPAC Name | [[4-[(1E)-buta-1,3-dienyl]-3,5-dimethylcyclohex-3-en-1-yl]amino]methanol;ethane;3,5,5-trimethyl-4-propa-1,2-dienylcyclohex-3-en-1-ol |
| SMILES | C=C/C=C/C1=C(C)CC(NCO)CC1C.C=C=CC1=C(C)CC(O)CC1(C)C.CC.CC |
| InChI | InChI=1S/C13H21NO.C12H18O.2C2H6/c1-4-5-6-13-10(2)7-12(14-9-15)8-11(13)3;1-5-6-11-9(2)7-10(13)8-12(11,3)4;2*1-2/h4-6,10,12,14-15H,1,7-9H2,2-3H3;6,10,13H,1,7-8H2,2-4H3;2*1-2H3/b6-5+;;; |
| InChIKey | KDQIAZLDENCYFQ-FWMLTEASSA-N |
| XLogP | 7.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|