About ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine
ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine (PubChem CID 142863536) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine.
Molecular Properties
| Compound Name | ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine |
| PubChem CID | 142863536 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine |
| SMILES | CC.Cc1nnc2c(n1)C=CCC=C2 |
| InChI | InChI=1S/C9H9N3.C2H6/c1-7-10-8-5-3-2-4-6-9(8)12-11-7;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | CHLCDMBZYMWGAU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine?
The IUPAC name of ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine (CID 142863536) is ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine.
What is the SMILES notation for ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine?
The canonical SMILES for ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine is CC.Cc1nnc2c(n1)C=CCC=C2.
What is the InChIKey of ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine?
The InChIKey is CHLCDMBZYMWGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.C2H6/c1-7-10-8-5-3-2-4-6-9(8)12-11-7;1-2/h3-6H,2H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine?
ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine has a molecular weight of 189.26 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-7H-cyclohepta[e][1,2,4]triazine is sourced from PubChem (CID 142863536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).