C15H27FN2 — CID 142864023
N-ethyl-N'-[(2E,4E,6Z)-8-fluoro-2,4-dimethylocta-2,4,6-trienyl]-N'-methylethane-1,2-diamine (PubChem CID 142864023) has the molecular formula C15H27FN2 and a molecular weight of 254.39 g/mol. Its IUPAC name is N-ethyl-N'-[(2E,4E,6Z)-8-fluoro-2,4-dimethylocta-2,4,6-trienyl]-N'-methylethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[(2E,4E,6Z)-8-fluoro-2,4-dimethylocta-2,4,6-trienyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142864023 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | N-ethyl-N'-[(2E,4E,6Z)-8-fluoro-2,4-dimethylocta-2,4,6-trienyl]-N'-methylethane-1,2-diamine |
| SMILES | CCNCCN(C)C/C(C)=C/C(C)=C/C=C\CF |
| InChI | InChI=1S/C15H27FN2/c1-5-17-10-11-18(4)13-15(3)12-14(2)8-6-7-9-16/h6-8,12,17H,5,9-11,13H2,1-4H3/b7-6-,14-8+,15-12+ |
| InChIKey | WLFRQMYAPPKWTL-GNVIZVHTSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|