molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone

C13H25NO2 — CID 142864289

IUPACmolecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone
SMILESO=C(CC1CCNCC1)C1CCCOCC1.[H][H]
InChIInChI=1S/C13H23NO2.H2/c15-13(10-11-3-6-14-7-4-11)12-2-1-8-16-9-5-12;/h11-12,14H,1-10H2;1H
InChIKeyZHVYHSOBVVIHLM-UHFFFAOYSA-N
MW227.35 g/mol
LogP2.01
Rot. Bonds3

About molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone

molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone (PubChem CID 142864289) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone.

Molecular Properties

Compound Namemolecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone
PubChem CID142864289
Molecular FormulaC13H25NO2
Molecular Weight227.35 g/mol
Exact Mass227.19
IUPAC Namemolecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone
SMILESO=C(CC1CCNCC1)C1CCCOCC1.[H][H]
InChIInChI=1S/C13H23NO2.H2/c15-13(10-11-3-6-14-7-4-11)12-2-1-8-16-9-5-12;/h11-12,14H,1-10H2;1H
InChIKeyZHVYHSOBVVIHLM-UHFFFAOYSA-N
XLogP2.01
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.35
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone?
The IUPAC name of molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone (CID 142864289) is molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone.
What is the SMILES notation for molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone?
The canonical SMILES for molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone is O=C(CC1CCNCC1)C1CCCOCC1.[H][H].
What is the InChIKey of molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone?
The InChIKey is ZHVYHSOBVVIHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2.H2/c15-13(10-11-3-6-14-7-4-11)12-2-1-8-16-9-5-12;/h11-12,14H,1-10H2;1H.
What are the key properties of molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone?
molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone has a molecular weight of 227.35 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1-(oxepan-4-yl)-2-piperidin-4-ylethanone is sourced from PubChem (CID 142864289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).