About (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal
(E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal (PubChem CID 14286432) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal.
Molecular Properties
| Compound Name | (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal |
| PubChem CID | 14286432 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal |
| SMILES | C/C(=C\C=O)C1(C)OCCO1 |
| InChI | InChI=1S/C8H12O3/c1-7(3-4-9)8(2)10-5-6-11-8/h3-4H,5-6H2,1-2H3/b7-3+ |
| InChIKey | TUCJRNBJFUFQRP-XVNBXDOJSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal?
The IUPAC name of (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal (CID 14286432) is (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal.
What is the SMILES notation for (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal?
The canonical SMILES for (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal is C/C(=C\C=O)C1(C)OCCO1.
What is the InChIKey of (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal?
The InChIKey is TUCJRNBJFUFQRP-XVNBXDOJSA-N. The full InChI is InChI=1S/C8H12O3/c1-7(3-4-9)8(2)10-5-6-11-8/h3-4H,5-6H2,1-2H3/b7-3+.
What are the key properties of (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal?
(E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal has a molecular weight of 156.18 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2-methyl-1,3-dioxolan-2-yl)but-2-enal is sourced from PubChem (CID 14286432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).