C21H33N4O10P — CID 142864415
[5-[5-[3-[[2-[2-(1-aminoethoxy)ethoxy]acetyl]amino]prop-1-ynyl]-4-methylidene-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dimethyl phosphate (PubChem CID 142864415) has the molecular formula C21H33N4O10P and a molecular weight of 532.49 g/mol. Its IUPAC name is [5-[5-[3-[[2-[2-(1-aminoethoxy)ethoxy]acetyl]amino]prop-1-ynyl]-4-methylidene-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dimethyl phosphate.
| Compound Name | [5-[5-[3-[[2-[2-(1-aminoethoxy)ethoxy]acetyl]amino]prop-1-ynyl]-4-methylidene-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dimethyl phosphate |
|---|---|
| PubChem CID | 142864415 |
| Molecular Formula | C21H33N4O10P |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | [5-[5-[3-[[2-[2-(1-aminoethoxy)ethoxy]acetyl]amino]prop-1-ynyl]-4-methylidene-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dimethyl phosphate |
| SMILES | C=C1NC(=O)N(C2CC(O)C(COP(=O)(OC)OC)O2)C=C1C#CCNC(=O)COCCOC(C)N |
| InChI | InChI=1S/C21H33N4O10P/c1-14-16(6-5-7-23-19(27)13-32-8-9-33-15(2)22)11-25(21(28)24-14)20-10-17(26)18(35-20)12-34-36(29,30-3)31-4/h11,15,17-18,20,26H,1,7-10,12-13,22H2,2-4H3,(H,23,27)(H,24,28) |
| InChIKey | IRDYFQOCZQPEOV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 180.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|