About 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane
1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane (PubChem CID 142864650) has the molecular formula C23H45O8P3
and a molecular weight of 542.53 g/mol. Its IUPAC name is 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane.
Molecular Properties
| Compound Name | 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane |
| PubChem CID | 142864650 |
| Molecular Formula | C23H45O8P3 |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane |
| SMILES | CCC.CCOP(C)(=O)Cc1cc(CP(=O)(OCC)OCC)cc(CP(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C20H37O8P3.C3H8/c1-7-24-29(6,21)15-18-12-19(16-30(22,25-8-2)26-9-3)14-20(13-18)17-31(23,27-10-4)28-11-5;1-3-2/h12-14H,7-11,15-17H2,1-6H3;3H2,1-2H3 |
| InChIKey | LCCYJIJHHLWYFW-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane?
The IUPAC name of 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane (CID 142864650) is 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane.
What is the SMILES notation for 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane?
The canonical SMILES for 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane is CCC.CCOP(C)(=O)Cc1cc(CP(=O)(OCC)OCC)cc(CP(=O)(OCC)OCC)c1.
What is the InChIKey of 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane?
The InChIKey is LCCYJIJHHLWYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37O8P3.C3H8/c1-7-24-29(6,21)15-18-12-19(16-30(22,25-8-2)26-9-3)14-20(13-18)17-31(23,27-10-4)28-11-5;1-3-2/h12-14H,7-11,15-17H2,1-6H3;3H2,1-2H3.
What are the key properties of 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane?
1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane has a molecular weight of 542.53 g/mol, XLogP of 8.08, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(diethoxyphosphorylmethyl)-5-[[ethoxy(methyl)phosphoryl]methyl]benzene;propane is sourced from PubChem (CID 142864650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).