C24H43N3O — CID 142864876
N,N-dimethyl-2-[(4E)-4-[(2E)-3-(3-piperidin-1-ylpropoxy)penta-2,4-dienylidene]azocan-1-yl]ethanamine (PubChem CID 142864876) has the molecular formula C24H43N3O and a molecular weight of 389.63 g/mol. Its IUPAC name is N,N-dimethyl-2-[(4E)-4-[(2E)-3-(3-piperidin-1-ylpropoxy)penta-2,4-dienylidene]azocan-1-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[(4E)-4-[(2E)-3-(3-piperidin-1-ylpropoxy)penta-2,4-dienylidene]azocan-1-yl]ethanamine |
|---|---|
| PubChem CID | 142864876 |
| Molecular Formula | C24H43N3O |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.34 |
| IUPAC Name | N,N-dimethyl-2-[(4E)-4-[(2E)-3-(3-piperidin-1-ylpropoxy)penta-2,4-dienylidene]azocan-1-yl]ethanamine |
| SMILES | C=C/C(=C\C=C1/CCCCN(CCN(C)C)CC1)OCCCN1CCCCC1 |
| InChI | InChI=1S/C24H43N3O/c1-4-24(28-22-10-18-26-15-7-5-8-16-26)13-12-23-11-6-9-17-27(19-14-23)21-20-25(2)3/h4,12-13H,1,5-11,14-22H2,2-3H3/b23-12+,24-13+ |
| InChIKey | IILDLSMRIDAUKT-MPDMMBQKSA-N |
| XLogP | 4.31 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|