C21H34N2O2 — CID 142864877
N-ethyl-N-[3-[3-(3-piperidin-1-ylpropoxy)phenyl]propyl]acetamide (PubChem CID 142864877) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N-ethyl-N-[3-[3-(3-piperidin-1-ylpropoxy)phenyl]propyl]acetamide.
| Compound Name | N-ethyl-N-[3-[3-(3-piperidin-1-ylpropoxy)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 142864877 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | N-ethyl-N-[3-[3-(3-piperidin-1-ylpropoxy)phenyl]propyl]acetamide |
| SMILES | CCN(CCCc1cccc(OCCCN2CCCCC2)c1)C(C)=O |
| InChI | InChI=1S/C21H34N2O2/c1-3-23(19(2)24)16-8-11-20-10-7-12-21(18-20)25-17-9-15-22-13-5-4-6-14-22/h7,10,12,18H,3-6,8-9,11,13-17H2,1-2H3 |
| InChIKey | DXFSYCSIKNVIAA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|