C27H41NO4 — CID 14286532
(12E)-7,7,12,16,17-pentamethyl-19-(2-methylpropyl)-6,8-dioxa-20-azatetracyclo[12.7.0.01,18.05,9]henicosa-12,15-diene-2,21-dione (PubChem CID 14286532) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is (12E)-7,7,12,16,17-pentamethyl-19-(2-methylpropyl)-6,8-dioxa-20-azatetracyclo[12.7.0.01,18.05,9]henicosa-12,15-diene-2,21-dione.
| Compound Name | (12E)-7,7,12,16,17-pentamethyl-19-(2-methylpropyl)-6,8-dioxa-20-azatetracyclo[12.7.0.01,18.05,9]henicosa-12,15-diene-2,21-dione |
|---|---|
| PubChem CID | 14286532 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | (12E)-7,7,12,16,17-pentamethyl-19-(2-methylpropyl)-6,8-dioxa-20-azatetracyclo[12.7.0.01,18.05,9]henicosa-12,15-diene-2,21-dione |
| SMILES | CC1=CC2/C=C(\C)CCC3OC(C)(C)OC3CCC(=O)C23C(=O)NC(CC(C)C)C3C1C |
| InChI | InChI=1S/C27H41NO4/c1-15(2)12-20-24-18(5)17(4)14-19-13-16(3)8-9-21-22(32-26(6,7)31-21)10-11-23(29)27(19,24)25(30)28-20/h13-15,18-22,24H,8-12H2,1-7H3,(H,28,30)/b16-13+ |
| InChIKey | LSWAGZSQKSSVQE-DTQAZKPQSA-N |
| XLogP | 4.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|