About (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal
(2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal (PubChem CID 142866206) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal.
Molecular Properties
| Compound Name | (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal |
| PubChem CID | 142866206 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal |
| SMILES | [H]/N=N/c1ccccc1NCO/C(C)=C/C(C=O)=C\C=C |
| InChI | InChI=1S/C15H17N3O2/c1-3-6-13(10-19)9-12(2)20-11-17-14-7-4-5-8-15(14)18-16/h3-10,16-17H,1,11H2,2H3/b12-9+,13-6+,18-16+ |
| InChIKey | KXDFIHSLKDFZMD-KOKRYIAHSA-N |
| XLogP | 3.95 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal?
The IUPAC name of (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal (CID 142866206) is (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal.
What is the SMILES notation for (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal?
The canonical SMILES for (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal is [H]/N=N/c1ccccc1NCO/C(C)=C/C(C=O)=C\C=C.
What is the InChIKey of (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal?
The InChIKey is KXDFIHSLKDFZMD-KOKRYIAHSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-3-6-13(10-19)9-12(2)20-11-17-14-7-4-5-8-15(14)18-16/h3-10,16-17H,1,11H2,2H3/b12-9+,13-6+,18-16+.
What are the key properties of (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal?
(2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal has a molecular weight of 271.32 g/mol, XLogP of 3.95, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(E)-2-[(2-diazenylanilino)methoxy]prop-1-enyl]penta-2,4-dienal is sourced from PubChem (CID 142866206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).