C27H30FNOS — CID 142866237
6-(5-fluoro-2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline (PubChem CID 142866237) has the molecular formula C27H30FNOS and a molecular weight of 435.61 g/mol. Its IUPAC name is 6-(5-fluoro-2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline.
| Compound Name | 6-(5-fluoro-2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
|---|---|
| PubChem CID | 142866237 |
| Molecular Formula | C27H30FNOS |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 6-(5-fluoro-2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-(2-phenylethylsulfanylmethyl)-1H-quinoline |
| SMILES | COC1=C(c2ccc3c(c2)C(CSCCc2ccccc2)=CC(C)(C)N3)C=C(F)CC1 |
| InChI | InChI=1S/C27H30FNOS/c1-27(2)17-21(18-31-14-13-19-7-5-4-6-8-19)23-15-20(9-11-25(23)29-27)24-16-22(28)10-12-26(24)30-3/h4-9,11,15-17,29H,10,12-14,18H2,1-3H3 |
| InChIKey | XOWKMXMSFJEWJW-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|