C25H33NO2 — CID 142866248
6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-[1-[(E)-pent-2-enoxy]ethyl]-1H-quinoline (PubChem CID 142866248) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-[1-[(E)-pent-2-enoxy]ethyl]-1H-quinoline.
| Compound Name | 6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-[1-[(E)-pent-2-enoxy]ethyl]-1H-quinoline |
|---|---|
| PubChem CID | 142866248 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 6-(2-methoxycyclohexa-1,5-dien-1-yl)-2,2-dimethyl-4-[1-[(E)-pent-2-enoxy]ethyl]-1H-quinoline |
| SMILES | CC/C=C/COC(C)C1=CC(C)(C)Nc2ccc(C3=C(OC)CCC=C3)cc21 |
| InChI | InChI=1S/C25H33NO2/c1-6-7-10-15-28-18(2)22-17-25(3,4)26-23-14-13-19(16-21(22)23)20-11-8-9-12-24(20)27-5/h7-8,10-11,13-14,16-18,26H,6,9,12,15H2,1-5H3/b10-7+ |
| InChIKey | JXRRHLPFPDIUOE-JXMROGBWSA-N |
| XLogP | 6.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|