C21H27FO3 — CID 142866416
17-acetyl-9-fluoro-17-hydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 142866416) has the molecular formula C21H27FO3 and a molecular weight of 346.44 g/mol. Its IUPAC name is 17-acetyl-9-fluoro-17-hydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-acetyl-9-fluoro-17-hydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142866416 |
| Molecular Formula | C21H27FO3 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 17-acetyl-9-fluoro-17-hydroxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)C1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3(F)CCC21C |
| InChI | InChI=1S/C21H27FO3/c1-13(23)21(25)9-7-16-17-5-4-14-12-15(24)6-8-18(14,2)20(17,22)11-10-19(16,21)3/h6,8,12,16-17,25H,4-5,7,9-11H2,1-3H3 |
| InChIKey | VBZBWFIDSIPIBC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |