C27H37F3N4O — CID 142866470
N,N-dicyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 142866470) has the molecular formula C27H37F3N4O and a molecular weight of 490.61 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N,N-dicyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 142866470 |
| Molecular Formula | C27H37F3N4O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N,N-dicyclohexyl-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C=C/C=C(\C=C/C)C1CC(C(F)(F)F)n2ncc(C(=O)N(C3CCCCC3)C3CCCCC3)c2N1 |
| InChI | InChI=1S/C27H37F3N4O/c1-3-11-19(12-4-2)23-17-24(27(28,29)30)34-25(32-23)22(18-31-34)26(35)33(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h3-4,11-12,18,20-21,23-24,32H,1,5-10,13-17H2,2H3/b12-4-,19-11+ |
| InChIKey | CCMPCPIKYHVAEY-JNZYCPCZSA-N |
| XLogP | 6.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|