C17H23N3O — CID 142866513
ethane;1-(7-methyl-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)ethenol (PubChem CID 142866513) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is ethane;1-(7-methyl-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)ethenol.
| Compound Name | ethane;1-(7-methyl-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)ethenol |
|---|---|
| PubChem CID | 142866513 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | ethane;1-(7-methyl-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)ethenol |
| SMILES | C=C(O)c1cnn2c1NC(c1ccccc1)CC2C.CC |
| InChI | InChI=1S/C15H17N3O.C2H6/c1-10-8-14(12-6-4-3-5-7-12)17-15-13(11(2)19)9-16-18(10)15;1-2/h3-7,9-10,14,17,19H,2,8H2,1H3;1-2H3 |
| InChIKey | JQYOBWHMUUPJRY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|