C20H27F3N4O — CID 142866585
N-(3,3-dimethylbutan-2-yl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 142866585) has the molecular formula C20H27F3N4O and a molecular weight of 396.46 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 142866585 |
| Molecular Formula | C20H27F3N4O |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C=C/C=C(\C=C)C1CC(C(F)(F)F)n2ncc(C(=O)NC(C)C(C)(C)C)c2N1 |
| InChI | InChI=1S/C20H27F3N4O/c1-7-9-13(8-2)15-10-16(20(21,22)23)27-17(26-15)14(11-24-27)18(28)25-12(3)19(4,5)6/h7-9,11-12,15-16,26H,1-2,10H2,3-6H3,(H,25,28)/b13-9+ |
| InChIKey | JWSCNZCARQNXRQ-UKTHLTGXSA-N |
| XLogP | 4.63 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|