C19H25F3N4O — CID 142866693
5-[(3E)-hexa-1,3,5-trien-3-yl]-N-(3-methylbutan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 142866693) has the molecular formula C19H25F3N4O and a molecular weight of 382.43 g/mol. Its IUPAC name is 5-[(3E)-hexa-1,3,5-trien-3-yl]-N-(3-methylbutan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-N-(3-methylbutan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 142866693 |
| Molecular Formula | C19H25F3N4O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 5-[(3E)-hexa-1,3,5-trien-3-yl]-N-(3-methylbutan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C=C/C=C(\C=C)C1CC(C(F)(F)F)n2ncc(C(=O)NC(C)C(C)C)c2N1 |
| InChI | InChI=1S/C19H25F3N4O/c1-6-8-13(7-2)15-9-16(19(20,21)22)26-17(25-15)14(10-23-26)18(27)24-12(5)11(3)4/h6-8,10-12,15-16,25H,1-2,9H2,3-5H3,(H,24,27)/b13-8+ |
| InChIKey | RDPVHXWQHBWBBJ-MDWZMJQESA-N |
| XLogP | 4.24 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|