C23H33FN4O — CID 142866812
[2-(2-fluoropropan-2-yl)piperidin-1-yl]-[5-[(3E)-hexa-1,3,5-trien-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone (PubChem CID 142866812) has the molecular formula C23H33FN4O and a molecular weight of 400.54 g/mol. Its IUPAC name is [2-(2-fluoropropan-2-yl)piperidin-1-yl]-[5-[(3E)-hexa-1,3,5-trien-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone.
| Compound Name | [2-(2-fluoropropan-2-yl)piperidin-1-yl]-[5-[(3E)-hexa-1,3,5-trien-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 142866812 |
| Molecular Formula | C23H33FN4O |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [2-(2-fluoropropan-2-yl)piperidin-1-yl]-[5-[(3E)-hexa-1,3,5-trien-3-yl]-7,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| SMILES | C=C/C=C(\C=C)C1CC(C)(C)n2ncc(C(=O)N3CCCCC3C(C)(C)F)c2N1 |
| InChI | InChI=1S/C23H33FN4O/c1-7-11-16(8-2)18-14-22(3,4)28-20(26-18)17(15-25-28)21(29)27-13-10-9-12-19(27)23(5,6)24/h7-8,11,15,18-19,26H,1-2,9-10,12-14H2,3-6H3/b16-11+ |
| InChIKey | AZZTZIFPBWFPTL-LFIBNONCSA-N |
| XLogP | 4.84 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|