About isoindole-1,3-dione;pent-4-en-1-ol
isoindole-1,3-dione;pent-4-en-1-ol (PubChem CID 142866906) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is isoindole-1,3-dione;pent-4-en-1-ol.
Molecular Properties
| Compound Name | isoindole-1,3-dione;pent-4-en-1-ol |
| PubChem CID | 142866906 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | isoindole-1,3-dione;pent-4-en-1-ol |
| SMILES | C=CCCCO.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H5NO2.C5H10O/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2-3-4-5-6/h1-4H,(H,9,10,11);2,6H,1,3-5H2 |
| InChIKey | KVVZGKYPBLEKMZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze isoindole-1,3-dione;pent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoindole-1,3-dione;pent-4-en-1-ol?
The IUPAC name of isoindole-1,3-dione;pent-4-en-1-ol (CID 142866906) is isoindole-1,3-dione;pent-4-en-1-ol.
What is the SMILES notation for isoindole-1,3-dione;pent-4-en-1-ol?
The canonical SMILES for isoindole-1,3-dione;pent-4-en-1-ol is C=CCCCO.O=C1NC(=O)c2ccccc21.
What is the InChIKey of isoindole-1,3-dione;pent-4-en-1-ol?
The InChIKey is KVVZGKYPBLEKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.C5H10O/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2-3-4-5-6/h1-4H,(H,9,10,11);2,6H,1,3-5H2.
What are the key properties of isoindole-1,3-dione;pent-4-en-1-ol?
isoindole-1,3-dione;pent-4-en-1-ol has a molecular weight of 233.27 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoindole-1,3-dione;pent-4-en-1-ol is sourced from PubChem (CID 142866906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).