C10H15N3 — CID 142867092
4-ethenyl-4,7,7-trimethyl-1,3,6-triazocine (PubChem CID 142867092) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-ethenyl-4,7,7-trimethyl-1,3,6-triazocine.
| Compound Name | 4-ethenyl-4,7,7-trimethyl-1,3,6-triazocine |
|---|---|
| PubChem CID | 142867092 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4-ethenyl-4,7,7-trimethyl-1,3,6-triazocine |
| SMILES | C=CC1(C)/C=N\C(C)(C)/C=N\C=N/1 |
| InChI | InChI=1S/C10H15N3/c1-5-10(4)7-12-9(2,3)6-11-8-13-10/h5-8H,1H2,2-4H3/b11-6-,12-7-,13-8- |
| InChIKey | OVXRXKMJCKFFEH-COOCMOKFSA-N |
| XLogP | 1.89 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|