About chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate
chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate (PubChem CID 142867685) has the molecular formula C11H14Cl2O4
and a molecular weight of 281.13 g/mol. Its IUPAC name is chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate |
| PubChem CID | 142867685 |
| Molecular Formula | C11H14Cl2O4 |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate |
| SMILES | C=C(CC1OC(=O)C(Cl)=C1C)C(=O)OC.CCl |
| InChI | InChI=1S/C10H11ClO4.CH3Cl/c1-5(9(12)14-3)4-7-6(2)8(11)10(13)15-7;1-2/h7H,1,4H2,2-3H3;1H3 |
| InChIKey | JDQLQURTHKZRKR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate?
The IUPAC name of chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate (CID 142867685) is chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate.
What is the SMILES notation for chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate?
The canonical SMILES for chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate is C=C(CC1OC(=O)C(Cl)=C1C)C(=O)OC.CCl.
What is the InChIKey of chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate?
The InChIKey is JDQLQURTHKZRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO4.CH3Cl/c1-5(9(12)14-3)4-7-6(2)8(11)10(13)15-7;1-2/h7H,1,4H2,2-3H3;1H3.
What are the key properties of chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate?
chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate has a molecular weight of 281.13 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;methyl 2-[(4-chloro-3-methyl-5-oxo-2H-furan-2-yl)methyl]prop-2-enoate is sourced from PubChem (CID 142867685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).