About [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane
[3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane (PubChem CID 142868081) has the molecular formula C14H14F4O2S
and a molecular weight of 322.32 g/mol. Its IUPAC name is [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane.
Molecular Properties
| Compound Name | [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane |
| PubChem CID | 142868081 |
| Molecular Formula | C14H14F4O2S |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane |
| SMILES | Fc1cc(C2=CCC3(CC2)OCCO3)cc(S(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F4O2S/c15-12-7-11(8-13(9-12)21(16,17)18)10-1-3-14(4-2-10)19-5-6-20-14/h1,7-9H,2-6H2 |
| InChIKey | YMNVDYIVWDZFRZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane?
The IUPAC name of [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane (CID 142868081) is [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane.
What is the SMILES notation for [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane?
The canonical SMILES for [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane is Fc1cc(C2=CCC3(CC2)OCCO3)cc(S(F)(F)F)c1.
What is the InChIKey of [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane?
The InChIKey is YMNVDYIVWDZFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F4O2S/c15-12-7-11(8-13(9-12)21(16,17)18)10-1-3-14(4-2-10)19-5-6-20-14/h1,7-9H,2-6H2.
What are the key properties of [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane?
[3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane has a molecular weight of 322.32 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-5-fluorophenyl]-trifluoro-λ4-sulfane is sourced from PubChem (CID 142868081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).