C18H26F2N4O — CID 142868112
3-[1-(3,4-difluorophenyl)piperidin-4-yl]-1-methyl-1-piperidin-4-ylurea (PubChem CID 142868112) has the molecular formula C18H26F2N4O and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[1-(3,4-difluorophenyl)piperidin-4-yl]-1-methyl-1-piperidin-4-ylurea.
| Compound Name | 3-[1-(3,4-difluorophenyl)piperidin-4-yl]-1-methyl-1-piperidin-4-ylurea |
|---|---|
| PubChem CID | 142868112 |
| Molecular Formula | C18H26F2N4O |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 3-[1-(3,4-difluorophenyl)piperidin-4-yl]-1-methyl-1-piperidin-4-ylurea |
| SMILES | CN(C(=O)NC1CCN(c2ccc(F)c(F)c2)CC1)C1CCNCC1 |
| InChI | InChI=1S/C18H26F2N4O/c1-23(14-4-8-21-9-5-14)18(25)22-13-6-10-24(11-7-13)15-2-3-16(19)17(20)12-15/h2-3,12-14,21H,4-11H2,1H3,(H,22,25) |
| InChIKey | YJXSBXRPLQCMRP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |