About (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane
(1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane (PubChem CID 142868136) has the molecular formula C13H16Cl2
and a molecular weight of 243.18 g/mol. Its IUPAC name is (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane |
| PubChem CID | 142868136 |
| Molecular Formula | C13H16Cl2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane |
| SMILES | ClC1=CC([C@@]23CCCCC2C3)CC(Cl)=C1 |
| InChI | InChI=1S/C13H16Cl2/c14-11-5-10(6-12(15)7-11)13-4-2-1-3-9(13)8-13/h5,7,9-10H,1-4,6,8H2/t9?,10?,13-/m1/s1 |
| InChIKey | UCKNJTBSYJAHFM-SRHKJQAYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane?
The IUPAC name of (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane (CID 142868136) is (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane.
What is the SMILES notation for (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane?
The canonical SMILES for (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane is ClC1=CC([C@@]23CCCCC2C3)CC(Cl)=C1.
What is the InChIKey of (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane?
The InChIKey is UCKNJTBSYJAHFM-SRHKJQAYSA-N. The full InChI is InChI=1S/C13H16Cl2/c14-11-5-10(6-12(15)7-11)13-4-2-1-3-9(13)8-13/h5,7,9-10H,1-4,6,8H2/t9?,10?,13-/m1/s1.
What are the key properties of (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane?
(1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane has a molecular weight of 243.18 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(3,5-dichlorocyclohexa-2,4-dien-1-yl)bicyclo[4.1.0]heptane is sourced from PubChem (CID 142868136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).