C26H27NO5 — CID 142868325
2-[4-[1-oxo-1-[2-(4-phenoxyphenyl)ethylamino]propan-2-yl]oxyphenyl]propanoic acid (PubChem CID 142868325) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 2-[4-[1-oxo-1-[2-(4-phenoxyphenyl)ethylamino]propan-2-yl]oxyphenyl]propanoic acid.
| Compound Name | 2-[4-[1-oxo-1-[2-(4-phenoxyphenyl)ethylamino]propan-2-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 142868325 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[4-[1-oxo-1-[2-(4-phenoxyphenyl)ethylamino]propan-2-yl]oxyphenyl]propanoic acid |
| SMILES | CC(Oc1ccc(C(C)C(=O)O)cc1)C(=O)NCCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO5/c1-18(26(29)30)21-10-14-23(15-11-21)31-19(2)25(28)27-17-16-20-8-12-24(13-9-20)32-22-6-4-3-5-7-22/h3-15,18-19H,16-17H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | JUEIPVXCPYTOER-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |