C17H21F3OS — CID 142868570
1-methyl-4-[(4Z,6Z)-4-methyl-8-(trifluoromethoxy)octa-4,6-dien-2-yl]sulfanylbenzene (PubChem CID 142868570) has the molecular formula C17H21F3OS and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-methyl-4-[(4Z,6Z)-4-methyl-8-(trifluoromethoxy)octa-4,6-dien-2-yl]sulfanylbenzene.
| Compound Name | 1-methyl-4-[(4Z,6Z)-4-methyl-8-(trifluoromethoxy)octa-4,6-dien-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 142868570 |
| Molecular Formula | C17H21F3OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-methyl-4-[(4Z,6Z)-4-methyl-8-(trifluoromethoxy)octa-4,6-dien-2-yl]sulfanylbenzene |
| SMILES | C/C(=C/C=C\COC(F)(F)F)CC(C)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C17H21F3OS/c1-13-7-9-16(10-8-13)22-15(3)12-14(2)6-4-5-11-21-17(18,19)20/h4-10,15H,11-12H2,1-3H3/b5-4-,14-6- |
| InChIKey | UPBJZYFRMILXBA-UUEBSLNCSA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|