C28H25ClF4N2O6 — CID 142868652
6-chloro-3-[3-(3-ethoxy-4-fluorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]-1,2-benzoxazole;ethane;formic acid (PubChem CID 142868652) has the molecular formula C28H25ClF4N2O6 and a molecular weight of 596.96 g/mol. Its IUPAC name is 6-chloro-3-[3-(3-ethoxy-4-fluorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]-1,2-benzoxazole;ethane;formic acid.
| Compound Name | 6-chloro-3-[3-(3-ethoxy-4-fluorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]-1,2-benzoxazole;ethane;formic acid |
|---|---|
| PubChem CID | 142868652 |
| Molecular Formula | C28H25ClF4N2O6 |
| Molecular Weight | 596.96 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 6-chloro-3-[3-(3-ethoxy-4-fluorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]-1,2-benzoxazole;ethane;formic acid |
| SMILES | CC.CCOc1cc(Oc2c(C)n(-c3noc4cc(Cl)ccc34)c3ccc(OC(F)(F)F)cc23)ccc1F.O=CO |
| InChI | InChI=1S/C25H17ClF4N2O4.C2H6.CH2O2/c1-3-33-22-12-15(5-8-19(22)27)34-23-13(2)32(24-17-7-4-14(26)10-21(17)36-31-24)20-9-6-16(11-18(20)23)35-25(28,29)30;1-2;2-1-3/h4-12H,3H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | OVDPLXWAEPPGLS-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.96 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|