C18H24O11 — CID 14286905
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-oxobut-1-enoxy]oxan-2-yl]methyl acetate (PubChem CID 14286905) has the molecular formula C18H24O11 and a molecular weight of 416.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-oxobut-1-enoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-oxobut-1-enoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14286905 |
| Molecular Formula | C18H24O11 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(E)-3-oxobut-1-enoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)/C=C/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H24O11/c1-9(19)6-7-24-18-17(28-13(5)23)16(27-12(4)22)15(26-11(3)21)14(29-18)8-25-10(2)20/h6-7,14-18H,8H2,1-5H3/b7-6+/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | COCWNOALBADFAT-YUTABHIPSA-N |
| XLogP | 0.19 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|