C19H26O10 — CID 14286908
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-methylbuta-1,3-dienoxy]oxan-2-yl]methyl acetate (PubChem CID 14286908) has the molecular formula C19H26O10 and a molecular weight of 414.41 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-methylbuta-1,3-dienoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-methylbuta-1,3-dienoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14286908 |
| Molecular Formula | C19H26O10 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(1E)-3-methylbuta-1,3-dienoxy]oxan-2-yl]methyl acetate |
| SMILES | C=C(C)/C=C/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H26O10/c1-10(2)7-8-24-19-18(28-14(6)23)17(27-13(5)22)16(26-12(4)21)15(29-19)9-25-11(3)20/h7-8,15-19H,1,9H2,2-6H3/b8-7+/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | WYABKHAWUSBJSQ-KOGRRYKMSA-N |
| XLogP | 1.18 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|