C22H18F3N3O3 — CID 142869305
(1aS,7bR)-4,7-difluoro-1,1a,2,7b-tetrahydrocyclopropa[c]chromene;[5-(3-fluorophenoxy)-2-pyridinyl]urea (PubChem CID 142869305) has the molecular formula C22H18F3N3O3 and a molecular weight of 429.40 g/mol. Its IUPAC name is (1aS,7bR)-4,7-difluoro-1,1a,2,7b-tetrahydrocyclopropa[c]chromene;[5-(3-fluorophenoxy)-2-pyridinyl]urea.
| Compound Name | (1aS,7bR)-4,7-difluoro-1,1a,2,7b-tetrahydrocyclopropa[c]chromene;[5-(3-fluorophenoxy)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 142869305 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (1aS,7bR)-4,7-difluoro-1,1a,2,7b-tetrahydrocyclopropa[c]chromene;[5-(3-fluorophenoxy)-2-pyridinyl]urea |
| SMILES | Fc1ccc(F)c2c1OC[C@H]1C[C@@H]21.NC(=O)Nc1ccc(Oc2cccc(F)c2)cn1 |
| InChI | InChI=1S/C12H10FN3O2.C10H8F2O/c13-8-2-1-3-9(6-8)18-10-4-5-11(15-7-10)16-12(14)17;11-7-1-2-8(12)10-9(7)6-3-5(6)4-13-10/h1-7H,(H3,14,15,16,17);1-2,5-6H,3-4H2/t;5-,6-/m.1/s1 |
| InChIKey | SLPUXMBTHMHEON-PZMDUNNRSA-N |
| XLogP | 4.96 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |