C20H19F4N3O5 — CID 142869389
3,4-bis(difluoromethoxy)-N-[(3S)-1-(1,2-dihydropyridin-4-ylmethyl)-2,6-dioxopiperidin-3-yl]benzamide (PubChem CID 142869389) has the molecular formula C20H19F4N3O5 and a molecular weight of 457.38 g/mol. Its IUPAC name is 3,4-bis(difluoromethoxy)-N-[(3S)-1-(1,2-dihydropyridin-4-ylmethyl)-2,6-dioxopiperidin-3-yl]benzamide.
| Compound Name | 3,4-bis(difluoromethoxy)-N-[(3S)-1-(1,2-dihydropyridin-4-ylmethyl)-2,6-dioxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 142869389 |
| Molecular Formula | C20H19F4N3O5 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3,4-bis(difluoromethoxy)-N-[(3S)-1-(1,2-dihydropyridin-4-ylmethyl)-2,6-dioxopiperidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CCC(=O)N(CC2=CCNC=C2)C1=O)c1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C20H19F4N3O5/c21-19(22)31-14-3-1-12(9-15(14)32-20(23)24)17(29)26-13-2-4-16(28)27(18(13)30)10-11-5-7-25-8-6-11/h1,3,5-7,9,13,19-20,25H,2,4,8,10H2,(H,26,29)/t13-/m0/s1 |
| InChIKey | OKWUCUWXMYMPKN-ZDUSSCGKSA-N |
| XLogP | 2.18 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|