About (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine (PubChem CID 142869597) has the molecular formula C14H17F6NS
and a molecular weight of 345.35 g/mol. Its IUPAC name is (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine |
| PubChem CID | 142869597 |
| Molecular Formula | C14H17F6NS |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine |
| SMILES | CSC(C)N(C)[C@@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F6NS/c1-8(21(3)9(2)22-4)10-5-11(13(15,16)17)7-12(6-10)14(18,19)20/h5-9H,1-4H3/t8-,9?/m0/s1 |
| InChIKey | QPBYUPOXKJVYOF-IENPIDJESA-N |
| XLogP | 5.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine?
The IUPAC name of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine (CID 142869597) is (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine.
What is the SMILES notation for (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine?
The canonical SMILES for (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine is CSC(C)N(C)[C@@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine?
The InChIKey is QPBYUPOXKJVYOF-IENPIDJESA-N. The full InChI is InChI=1S/C14H17F6NS/c1-8(21(3)9(2)22-4)10-5-11(13(15,16)17)7-12(6-10)14(18,19)20/h5-9H,1-4H3/t8-,9?/m0/s1.
What are the key properties of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine?
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine has a molecular weight of 345.35 g/mol, XLogP of 5.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methyl-N-(1-methylsulfanylethyl)ethanamine is sourced from PubChem (CID 142869597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).