C18H21BrN6S — CID 142870415
3-bromo-5-(1-methylsulfanylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 142870415) has the molecular formula C18H21BrN6S and a molecular weight of 433.38 g/mol. Its IUPAC name is 3-bromo-5-(1-methylsulfanylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-bromo-5-(1-methylsulfanylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 142870415 |
| Molecular Formula | C18H21BrN6S |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 3-bromo-5-(1-methylsulfanylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CSN1CCC(c2cc(NCc3cccnc3)n3ncc(Br)c3n2)CC1 |
| InChI | InChI=1S/C18H21BrN6S/c1-26-24-7-4-14(5-8-24)16-9-17(21-11-13-3-2-6-20-10-13)25-18(23-16)15(19)12-22-25/h2-3,6,9-10,12,14,21H,4-5,7-8,11H2,1H3 |
| InChIKey | UGYAVNZXNUEFQP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|