C21H26BrN5O — CID 142870766
2-[3-bromo-7-[3-[cyclopentyl(methyl)amino]propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]phenol (PubChem CID 142870766) has the molecular formula C21H26BrN5O and a molecular weight of 444.38 g/mol. Its IUPAC name is 2-[3-bromo-7-[3-[cyclopentyl(methyl)amino]propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]phenol.
| Compound Name | 2-[3-bromo-7-[3-[cyclopentyl(methyl)amino]propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]phenol |
|---|---|
| PubChem CID | 142870766 |
| Molecular Formula | C21H26BrN5O |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[3-bromo-7-[3-[cyclopentyl(methyl)amino]propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]phenol |
| SMILES | CN(CCCNc1cc(-c2ccccc2O)nc2c(Br)cnn12)C1CCCC1 |
| InChI | InChI=1S/C21H26BrN5O/c1-26(15-7-2-3-8-15)12-6-11-23-20-13-18(16-9-4-5-10-19(16)28)25-21-17(22)14-24-27(20)21/h4-5,9-10,13-15,23,28H,2-3,6-8,11-12H2,1H3 |
| InChIKey | ZSGZQUSEBJVPBH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|